C6H6Cl8 — CID 121282276
1,1,1,2,3-pentachloropropane;1,1,3-trichloroprop-1-ene (PubChem CID 121282276) has the molecular formula C6H6Cl8 and a molecular weight of 361.74 g/mol. Its IUPAC name is 1,1,1,2,3-pentachloropropane;1,1,3-trichloroprop-1-ene.
| Compound Name | 1,1,1,2,3-pentachloropropane;1,1,3-trichloroprop-1-ene |
|---|---|
| PubChem CID | 121282276 |
| Molecular Formula | C6H6Cl8 |
| Molecular Weight | 361.74 g/mol |
| Exact Mass | 357.80 |
| IUPAC Name | 1,1,1,2,3-pentachloropropane;1,1,3-trichloroprop-1-ene |
| SMILES | ClCC(Cl)C(Cl)(Cl)Cl.ClCC=C(Cl)Cl |
| InChI | InChI=1S/C3H3Cl5.C3H3Cl3/c4-1-2(5)3(6,7)8;4-2-1-3(5)6/h2H,1H2;1H,2H2 |
| InChIKey | HLOLGCNJDQPWJL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.74 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|