C18H26O2 — CID 121283174
(1R,2R,3R,4R,6R)-3-ethynyl-2-[(1R,2R)-1-hydroxy-2-methylpenta-3,4-dienyl]-4,7,7-trimethylbicyclo[4.1.0]heptan-3-ol (PubChem CID 121283174) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (1R,2R,3R,4R,6R)-3-ethynyl-2-[(1R,2R)-1-hydroxy-2-methylpenta-3,4-dienyl]-4,7,7-trimethylbicyclo[4.1.0]heptan-3-ol.
| Compound Name | (1R,2R,3R,4R,6R)-3-ethynyl-2-[(1R,2R)-1-hydroxy-2-methylpenta-3,4-dienyl]-4,7,7-trimethylbicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 121283174 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (1R,2R,3R,4R,6R)-3-ethynyl-2-[(1R,2R)-1-hydroxy-2-methylpenta-3,4-dienyl]-4,7,7-trimethylbicyclo[4.1.0]heptan-3-ol |
| SMILES | C#C[C@]1(O)[C@@H]([C@H](O)[C@H](C)C=C=C)[C@H]2[C@@H](C[C@H]1C)C2(C)C |
| InChI | InChI=1S/C18H26O2/c1-7-9-11(3)16(19)15-14-13(17(14,5)6)10-12(4)18(15,20)8-2/h2,9,11-16,19-20H,1,10H2,3-6H3/t11-,12-,13-,14-,15-,16-,18-/m1/s1 |
| InChIKey | DNPPKZVIYJVKLH-QZNQKGLUSA-N |
| XLogP | 2.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|