C22H29BrO4 — CID 121283193
2-[(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]-5-bromo-2-methylpentanoic acid (PubChem CID 121283193) has the molecular formula C22H29BrO4 and a molecular weight of 437.37 g/mol. Its IUPAC name is 2-[(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]-5-bromo-2-methylpentanoic acid.
| Compound Name | 2-[(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]-5-bromo-2-methylpentanoic acid |
|---|---|
| PubChem CID | 121283193 |
| Molecular Formula | C22H29BrO4 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-[(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]-5-bromo-2-methylpentanoic acid |
| SMILES | CC1=CC[C@@H]2[C@@H](C1)c1c(O)cc(C(C)(CCCBr)C(=O)O)cc1OC2(C)C |
| InChI | InChI=1S/C22H29BrO4/c1-13-6-7-16-15(10-13)19-17(24)11-14(12-18(19)27-21(16,2)3)22(4,20(25)26)8-5-9-23/h6,11-12,15-16,24H,5,7-10H2,1-4H3,(H,25,26)/t15-,16-,22?/m1/s1 |
| InChIKey | XJOHGHGHSGGURE-AXJGWOQESA-N |
| XLogP | 5.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|