About 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine
2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine (PubChem CID 121284132) has the molecular formula C10H13BrN2O
and a molecular weight of 257.13 g/mol. Its IUPAC name is 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine.
Molecular Properties
| Compound Name | 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine |
| PubChem CID | 121284132 |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine |
| SMILES | C[C@@H]1CNC[C@H]1Oc1cccc(Br)n1 |
| InChI | InChI=1S/C10H13BrN2O/c1-7-5-12-6-8(7)14-10-4-2-3-9(11)13-10/h2-4,7-8,12H,5-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | JWPZGZNKXCJKAL-HTQZYQBOSA-N |
| XLogP | 1.83 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine?
The IUPAC name of 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine (CID 121284132) is 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine.
What is the SMILES notation for 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine?
The canonical SMILES for 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine is C[C@@H]1CNC[C@H]1Oc1cccc(Br)n1.
What is the InChIKey of 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine?
The InChIKey is JWPZGZNKXCJKAL-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H13BrN2O/c1-7-5-12-6-8(7)14-10-4-2-3-9(11)13-10/h2-4,7-8,12H,5-6H2,1H3/t7-,8-/m1/s1.
What are the key properties of 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine?
2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine has a molecular weight of 257.13 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-[(3S,4R)-4-methylpyrrolidin-3-yl]oxypyridine is sourced from PubChem (CID 121284132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).