C31H26ClFN6O5S — CID 121284443
N-[(1S,3R)-3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]cyclohexyl]-2-fluoro-4-nitrobenzamide (PubChem CID 121284443) has the molecular formula C31H26ClFN6O5S and a molecular weight of 649.10 g/mol. Its IUPAC name is N-[(1S,3R)-3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]cyclohexyl]-2-fluoro-4-nitrobenzamide.
| Compound Name | N-[(1S,3R)-3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]cyclohexyl]-2-fluoro-4-nitrobenzamide |
|---|---|
| PubChem CID | 121284443 |
| Molecular Formula | C31H26ClFN6O5S |
| Molecular Weight | 649.10 g/mol |
| Exact Mass | 648.14 |
| IUPAC Name | N-[(1S,3R)-3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]cyclohexyl]-2-fluoro-4-nitrobenzamide |
| SMILES | O=C(N[C@H]1CCC[C@@H](Nc2ncc(Cl)c(-c3cn(S(=O)(=O)c4ccccc4)c4ccccc34)n2)C1)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C31H26ClFN6O5S/c32-26-17-34-31(36-20-8-6-7-19(15-20)35-30(40)24-14-13-21(39(41)42)16-27(24)33)37-29(26)25-18-38(28-12-5-4-11-23(25)28)45(43,44)22-9-2-1-3-10-22/h1-5,9-14,16-20H,6-8,15H2,(H,35,40)(H,34,36,37)/t19-,20+/m0/s1 |
| InChIKey | XFLIHUYUDPGTNZ-VQTJNVASSA-N |
| XLogP | 6.19 |
| TPSA | 149.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.10 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|