C25H24ClFN6O — CID 121284459
4-amino-N-[(1R,3S,5S)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-5-fluorocyclohexyl]benzamide (PubChem CID 121284459) has the molecular formula C25H24ClFN6O and a molecular weight of 478.96 g/mol. Its IUPAC name is 4-amino-N-[(1R,3S,5S)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-5-fluorocyclohexyl]benzamide.
| Compound Name | 4-amino-N-[(1R,3S,5S)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-5-fluorocyclohexyl]benzamide |
|---|---|
| PubChem CID | 121284459 |
| Molecular Formula | C25H24ClFN6O |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 4-amino-N-[(1R,3S,5S)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-5-fluorocyclohexyl]benzamide |
| SMILES | Nc1ccc(C(=O)N[C@H]2C[C@@H](F)C[C@@H](Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)C2)cc1 |
| InChI | InChI=1S/C25H24ClFN6O/c26-21-13-30-25(33-23(21)20-12-29-22-4-2-1-3-19(20)22)32-18-10-15(27)9-17(11-18)31-24(34)14-5-7-16(28)8-6-14/h1-8,12-13,15,17-18,29H,9-11,28H2,(H,31,34)(H,30,32,33)/t15-,17+,18-/m1/s1 |
| InChIKey | OMMPQSOXNDXTLF-BPQIPLTHSA-N |
| XLogP | 4.96 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|