C11H18N4 — CID 121284507
1,1,3,3-tetramethyl-2-(1H-pyridin-2-ylidenemethyl)guanidine (PubChem CID 121284507) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(1H-pyridin-2-ylidenemethyl)guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-(1H-pyridin-2-ylidenemethyl)guanidine |
|---|---|
| PubChem CID | 121284507 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(1H-pyridin-2-ylidenemethyl)guanidine |
| SMILES | CN(C)C(=NC=C1C=CC=CN1)N(C)C |
| InChI | InChI=1S/C11H18N4/c1-14(2)11(15(3)4)13-9-10-7-5-6-8-12-10/h5-9,12H,1-4H3 |
| InChIKey | MJKRQMNNTVUBSD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|