C10H26N4O4S6 — CID 121284660
(2R,3R)-2,3-diamino-4-[2-[[(2R,3R)-2,3-diamino-4-sulfinobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinic acid (PubChem CID 121284660) has the molecular formula C10H26N4O4S6 and a molecular weight of 458.74 g/mol. Its IUPAC name is (2R,3R)-2,3-diamino-4-[2-[[(2R,3R)-2,3-diamino-4-sulfinobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinic acid.
| Compound Name | (2R,3R)-2,3-diamino-4-[2-[[(2R,3R)-2,3-diamino-4-sulfinobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinic acid |
|---|---|
| PubChem CID | 121284660 |
| Molecular Formula | C10H26N4O4S6 |
| Molecular Weight | 458.74 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | (2R,3R)-2,3-diamino-4-[2-[[(2R,3R)-2,3-diamino-4-sulfinobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinic acid |
| SMILES | N[C@@H](CSSCCSSC[C@H](N)[C@@H](N)CS(=O)O)[C@@H](N)CS(=O)O |
| InChI | InChI=1S/C10H26N4O4S6/c11-7(9(13)5-23(15)16)3-21-19-1-2-20-22-4-8(12)10(14)6-24(17)18/h7-10H,1-6,11-14H2,(H,15,16)(H,17,18)/t7-,8-,9-,10-/m0/s1 |
| InChIKey | SCGDZBQIVDGDRI-XKNYDFJKSA-N |
| XLogP | -0.50 |
| TPSA | 178.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.74 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|