C8H22N4O4S4 — CID 121284662
(2R,3R)-2,3-diamino-4-[[(2R,3R)-2,3-diamino-4-sulfinobutyl]disulfanyl]butane-1-sulfinic acid (PubChem CID 121284662) has the molecular formula C8H22N4O4S4 and a molecular weight of 366.56 g/mol. Its IUPAC name is (2R,3R)-2,3-diamino-4-[[(2R,3R)-2,3-diamino-4-sulfinobutyl]disulfanyl]butane-1-sulfinic acid.
| Compound Name | (2R,3R)-2,3-diamino-4-[[(2R,3R)-2,3-diamino-4-sulfinobutyl]disulfanyl]butane-1-sulfinic acid |
|---|---|
| PubChem CID | 121284662 |
| Molecular Formula | C8H22N4O4S4 |
| Molecular Weight | 366.56 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (2R,3R)-2,3-diamino-4-[[(2R,3R)-2,3-diamino-4-sulfinobutyl]disulfanyl]butane-1-sulfinic acid |
| SMILES | N[C@@H](CSSC[C@H](N)[C@@H](N)CS(=O)O)[C@@H](N)CS(=O)O |
| InChI | InChI=1S/C8H22N4O4S4/c9-5(7(11)3-19(13)14)1-17-18-2-6(10)8(12)4-20(15)16/h5-8H,1-4,9-12H2,(H,13,14)(H,15,16)/t5-,6-,7-,8-/m0/s1 |
| InChIKey | CDWSRTQMIABIDF-XAMCCFCMSA-N |
| XLogP | -1.88 |
| TPSA | 178.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.56 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|