C8H14N12O4S4 — CID 121284669
(2R,3R)-2,3-diazido-4-[[(2R,3R)-2,3-diazido-4-sulfinobutyl]disulfanyl]butane-1-sulfinic acid (PubChem CID 121284669) has the molecular formula C8H14N12O4S4 and a molecular weight of 470.55 g/mol. Its IUPAC name is (2R,3R)-2,3-diazido-4-[[(2R,3R)-2,3-diazido-4-sulfinobutyl]disulfanyl]butane-1-sulfinic acid.
| Compound Name | (2R,3R)-2,3-diazido-4-[[(2R,3R)-2,3-diazido-4-sulfinobutyl]disulfanyl]butane-1-sulfinic acid |
|---|---|
| PubChem CID | 121284669 |
| Molecular Formula | C8H14N12O4S4 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | (2R,3R)-2,3-diazido-4-[[(2R,3R)-2,3-diazido-4-sulfinobutyl]disulfanyl]butane-1-sulfinic acid |
| SMILES | [N-]=[N+]=N[C@@H](CSSC[C@H](N=[N+]=[N-])[C@H](CS(=O)O)N=[N+]=[N-])[C@H](CS(=O)O)N=[N+]=[N-] |
| InChI | InChI=1S/C8H14N12O4S4/c9-17-13-5(7(15-19-11)3-27(21)22)1-25-26-2-6(14-18-10)8(16-20-12)4-28(23)24/h5-8H,1-4H2,(H,21,22)(H,23,24)/t5-,6-,7-,8-/m0/s1 |
| InChIKey | FLWKBSJONOUJIW-XAMCCFCMSA-N |
| XLogP | 3.53 |
| TPSA | 269.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|