C13H18N2 — CID 121285254
(3Z,5Z,8Z)-2-methyl-1-[(Z)-prop-1-enyl]-2,7-dihydroazecin-10-imine (PubChem CID 121285254) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (3Z,5Z,8Z)-2-methyl-1-[(Z)-prop-1-enyl]-2,7-dihydroazecin-10-imine.
| Compound Name | (3Z,5Z,8Z)-2-methyl-1-[(Z)-prop-1-enyl]-2,7-dihydroazecin-10-imine |
|---|---|
| PubChem CID | 121285254 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (3Z,5Z,8Z)-2-methyl-1-[(Z)-prop-1-enyl]-2,7-dihydroazecin-10-imine |
| SMILES | [H]/N=C1\C=C/C/C=C\C=C/C(C)N1/C=C\C |
| InChI | InChI=1S/C13H18N2/c1-3-11-15-12(2)9-7-5-4-6-8-10-13(15)14/h3-5,7-12,14H,6H2,1-2H3/b5-4-,9-7-,10-8-,11-3-,14-13+ |
| InChIKey | KOKJJCLKNJKAMG-DDEZZGALSA-N |
| XLogP | 3.26 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|