C22H18FN5O5 — CID 121285496
amino 4-[4-[2-azido-1-[4-(cyclopropanecarbonyl)phenoxy]ethyl]-1,3-oxazol-2-yl]-2-fluorobenzoate (PubChem CID 121285496) has the molecular formula C22H18FN5O5 and a molecular weight of 451.41 g/mol. Its IUPAC name is amino 4-[4-[2-azido-1-[4-(cyclopropanecarbonyl)phenoxy]ethyl]-1,3-oxazol-2-yl]-2-fluorobenzoate.
| Compound Name | amino 4-[4-[2-azido-1-[4-(cyclopropanecarbonyl)phenoxy]ethyl]-1,3-oxazol-2-yl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 121285496 |
| Molecular Formula | C22H18FN5O5 |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | amino 4-[4-[2-azido-1-[4-(cyclopropanecarbonyl)phenoxy]ethyl]-1,3-oxazol-2-yl]-2-fluorobenzoate |
| SMILES | [N-]=[N+]=NCC(Oc1ccc(C(=O)C2CC2)cc1)c1coc(-c2ccc(C(=O)ON)c(F)c2)n1 |
| InChI | InChI=1S/C22H18FN5O5/c23-17-9-14(5-8-16(17)22(30)33-25)21-27-18(11-31-21)19(10-26-28-24)32-15-6-3-13(4-7-15)20(29)12-1-2-12/h3-9,11-12,19H,1-2,10,25H2 |
| InChIKey | ZVRRAXPDQNJYKS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 153.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|