About 2,9-dimethyl-1,4-dihydropurin-6-amine
2,9-dimethyl-1,4-dihydropurin-6-amine (PubChem CID 121285719) has the molecular formula C7H11N5
and a molecular weight of 165.20 g/mol. Its IUPAC name is 2,9-dimethyl-1,4-dihydropurin-6-amine.
Molecular Properties
| Compound Name | 2,9-dimethyl-1,4-dihydropurin-6-amine |
| PubChem CID | 121285719 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 2,9-dimethyl-1,4-dihydropurin-6-amine |
| SMILES | CC1=NC2C(=C(N)N1)N=CN2C |
| InChI | InChI=1S/C7H11N5/c1-4-10-6(8)5-7(11-4)12(2)3-9-5/h3,7H,8H2,1-2H3,(H,10,11) |
| InChIKey | KNDAXMGLBRXEKC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,9-dimethyl-1,4-dihydropurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-dimethyl-1,4-dihydropurin-6-amine?
The IUPAC name of 2,9-dimethyl-1,4-dihydropurin-6-amine (CID 121285719) is 2,9-dimethyl-1,4-dihydropurin-6-amine.
What is the SMILES notation for 2,9-dimethyl-1,4-dihydropurin-6-amine?
The canonical SMILES for 2,9-dimethyl-1,4-dihydropurin-6-amine is CC1=NC2C(=C(N)N1)N=CN2C.
What is the InChIKey of 2,9-dimethyl-1,4-dihydropurin-6-amine?
The InChIKey is KNDAXMGLBRXEKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N5/c1-4-10-6(8)5-7(11-4)12(2)3-9-5/h3,7H,8H2,1-2H3,(H,10,11).
What are the key properties of 2,9-dimethyl-1,4-dihydropurin-6-amine?
2,9-dimethyl-1,4-dihydropurin-6-amine has a molecular weight of 165.20 g/mol, XLogP of -0.56, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-dimethyl-1,4-dihydropurin-6-amine is sourced from PubChem (CID 121285719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).