C8H9NO4 — CID 121286692
3-aminooxycarbonyl-1-methylcyclopenta-2,4-diene-1-carboxylic acid (PubChem CID 121286692) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 3-aminooxycarbonyl-1-methylcyclopenta-2,4-diene-1-carboxylic acid.
| Compound Name | 3-aminooxycarbonyl-1-methylcyclopenta-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 121286692 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 3-aminooxycarbonyl-1-methylcyclopenta-2,4-diene-1-carboxylic acid |
| SMILES | CC1(C(=O)O)C=CC(C(=O)ON)=C1 |
| InChI | InChI=1S/C8H9NO4/c1-8(7(11)12)3-2-5(4-8)6(10)13-9/h2-4H,9H2,1H3,(H,11,12) |
| InChIKey | UBMWXYVRQXCMSE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|