About tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate
tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate (PubChem CID 121286754) has the molecular formula C17H17IN2O4S
and a molecular weight of 472.30 g/mol. Its IUPAC name is tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate |
| PubChem CID | 121286754 |
| Molecular Formula | C17H17IN2O4S |
| Molecular Weight | 472.30 g/mol |
| Exact Mass | 472.00 |
| IUPAC Name | tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate |
| SMILES | Cc1c(-c2ncco2)sc2c(I)cn(CC(=O)OC(C)(C)C)c(=O)c12 |
| InChI | InChI=1S/C17H17IN2O4S/c1-9-12-14(25-13(9)15-19-5-6-23-15)10(18)7-20(16(12)22)8-11(21)24-17(2,3)4/h5-7H,8H2,1-4H3 |
| InChIKey | FKXWDCBEZXBQLC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate?
The IUPAC name of tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate (CID 121286754) is tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate.
What is the SMILES notation for tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate?
The canonical SMILES for tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate is Cc1c(-c2ncco2)sc2c(I)cn(CC(=O)OC(C)(C)C)c(=O)c12.
What is the InChIKey of tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate?
The InChIKey is FKXWDCBEZXBQLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17IN2O4S/c1-9-12-14(25-13(9)15-19-5-6-23-15)10(18)7-20(16(12)22)8-11(21)24-17(2,3)4/h5-7H,8H2,1-4H3.
What are the key properties of tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate?
tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate has a molecular weight of 472.30 g/mol, XLogP of 3.97, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[7-iodo-3-methyl-2-(1,3-oxazol-2-yl)-4-oxothieno[3,2-c]pyridin-5-yl]acetate is sourced from PubChem (CID 121286754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).