C18H25NO3 — CID 121286773
1-(2-ethyl-2,3-dihydropyrrol-1-yl)-2-(3-hydroxy-1-adamantyl)ethane-1,2-dione (PubChem CID 121286773) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 1-(2-ethyl-2,3-dihydropyrrol-1-yl)-2-(3-hydroxy-1-adamantyl)ethane-1,2-dione.
| Compound Name | 1-(2-ethyl-2,3-dihydropyrrol-1-yl)-2-(3-hydroxy-1-adamantyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 121286773 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-(2-ethyl-2,3-dihydropyrrol-1-yl)-2-(3-hydroxy-1-adamantyl)ethane-1,2-dione |
| SMILES | CCC1CC=CN1C(=O)C(=O)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C18H25NO3/c1-2-14-4-3-5-19(14)16(21)15(20)17-7-12-6-13(8-17)10-18(22,9-12)11-17/h3,5,12-14,22H,2,4,6-11H2,1H3 |
| InChIKey | PPKJWYDNDVHUBD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|