C19H28N2O3 — CID 121286956
2-[2-[(3S)-3-hydroxy-1,3,5-trimethylcyclooctyl]-2-oxoacetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile (PubChem CID 121286956) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2-[2-[(3S)-3-hydroxy-1,3,5-trimethylcyclooctyl]-2-oxoacetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile.
| Compound Name | 2-[2-[(3S)-3-hydroxy-1,3,5-trimethylcyclooctyl]-2-oxoacetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile |
|---|---|
| PubChem CID | 121286956 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2-[2-[(3S)-3-hydroxy-1,3,5-trimethylcyclooctyl]-2-oxoacetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile |
| SMILES | CC1CCCC(C)(C(=O)C(=O)N2C(C#N)CC3CC32)C[C@@](C)(O)C1 |
| InChI | InChI=1S/C19H28N2O3/c1-12-5-4-6-18(2,11-19(3,24)9-12)16(22)17(23)21-14(10-20)7-13-8-15(13)21/h12-15,24H,4-9,11H2,1-3H3/t12?,13?,14?,15?,18?,19-/m0/s1 |
| InChIKey | CVPKOVCMLDSKGQ-DNCKVWLOSA-N |
| XLogP | 2.43 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|