C18H28N2O4 — CID 121286957
1-[2-[(3S)-3-hydroxy-1,3,5-trimethylcyclooctyl]-2-oxoacetyl]-2,3-dihydropyrrole-2-carboxamide (PubChem CID 121286957) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 1-[2-[(3S)-3-hydroxy-1,3,5-trimethylcyclooctyl]-2-oxoacetyl]-2,3-dihydropyrrole-2-carboxamide.
| Compound Name | 1-[2-[(3S)-3-hydroxy-1,3,5-trimethylcyclooctyl]-2-oxoacetyl]-2,3-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 121286957 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-[2-[(3S)-3-hydroxy-1,3,5-trimethylcyclooctyl]-2-oxoacetyl]-2,3-dihydropyrrole-2-carboxamide |
| SMILES | CC1CCCC(C)(C(=O)C(=O)N2C=CCC2C(N)=O)C[C@@](C)(O)C1 |
| InChI | InChI=1S/C18H28N2O4/c1-12-6-4-8-17(2,11-18(3,24)10-12)14(21)16(23)20-9-5-7-13(20)15(19)22/h5,9,12-13,24H,4,6-8,10-11H2,1-3H3,(H2,19,22)/t12?,13?,17?,18-/m0/s1 |
| InChIKey | ZZNSUQNNWHSIHC-POHPQNGGSA-N |
| XLogP | 1.51 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|