C47H27N11 — CID 121287276
2-[4-[6,9-bis(4-phenyl-1,3,5-triazin-2-yl)phenanthren-2-yl]-1,3,5-triazin-2-yl]-1,10-phenanthroline (PubChem CID 121287276) has the molecular formula C47H27N11 and a molecular weight of 745.81 g/mol. Its IUPAC name is 2-[4-[6,9-bis(4-phenyl-1,3,5-triazin-2-yl)phenanthren-2-yl]-1,3,5-triazin-2-yl]-1,10-phenanthroline.
| Compound Name | 2-[4-[6,9-bis(4-phenyl-1,3,5-triazin-2-yl)phenanthren-2-yl]-1,3,5-triazin-2-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 121287276 |
| Molecular Formula | C47H27N11 |
| Molecular Weight | 745.81 g/mol |
| Exact Mass | 745.25 |
| IUPAC Name | 2-[4-[6,9-bis(4-phenyl-1,3,5-triazin-2-yl)phenanthren-2-yl]-1,3,5-triazin-2-yl]-1,10-phenanthroline |
| SMILES | c1ccc(-c2ncnc(-c3ccc4c(-c5ncnc(-c6ccccc6)n5)cc5cc(-c6ncnc(-c7ccc8ccc9cccnc9c8n7)n6)ccc5c4c3)n2)cc1 |
| InChI | InChI=1S/C47H27N11/c1-3-8-30(9-4-1)42-49-25-51-45(56-42)33-16-19-36-37(23-33)35-18-15-32(22-34(35)24-38(36)46-53-26-50-43(57-46)31-10-5-2-6-11-31)44-52-27-54-47(58-44)39-20-17-29-14-13-28-12-7-21-48-40(28)41(29)55-39/h1-27H |
| InChIKey | ITEDPSJKCVJEGQ-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 141.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.81 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|