C13H23F6NO — CID 121288268
N,N-diethyl-2-(2,2,4,4,6,6-hexafluoroheptoxy)ethanamine (PubChem CID 121288268) has the molecular formula C13H23F6NO and a molecular weight of 323.32 g/mol. Its IUPAC name is N,N-diethyl-2-(2,2,4,4,6,6-hexafluoroheptoxy)ethanamine.
| Compound Name | N,N-diethyl-2-(2,2,4,4,6,6-hexafluoroheptoxy)ethanamine |
|---|---|
| PubChem CID | 121288268 |
| Molecular Formula | C13H23F6NO |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N,N-diethyl-2-(2,2,4,4,6,6-hexafluoroheptoxy)ethanamine |
| SMILES | CCN(CC)CCOCC(F)(F)CC(F)(F)CC(C)(F)F |
| InChI | InChI=1S/C13H23F6NO/c1-4-20(5-2)6-7-21-10-13(18,19)9-12(16,17)8-11(3,14)15/h4-10H2,1-3H3 |
| InChIKey | NAZQGXAHTXCKDH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|