C34H56O5S — CID 121288480
(3S,4S,6S)-2-ethyl-6-[[(3S,4S,6R)-4-[(2R,5S,6S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]methoxy]-3,4,5-trimethyloxane (PubChem CID 121288480) has the molecular formula C34H56O5S and a molecular weight of 576.88 g/mol. Its IUPAC name is (3S,4S,6S)-2-ethyl-6-[[(3S,4S,6R)-4-[(2R,5S,6S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]methoxy]-3,4,5-trimethyloxane.
| Compound Name | (3S,4S,6S)-2-ethyl-6-[[(3S,4S,6R)-4-[(2R,5S,6S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]methoxy]-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 121288480 |
| Molecular Formula | C34H56O5S |
| Molecular Weight | 576.88 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | (3S,4S,6S)-2-ethyl-6-[[(3S,4S,6R)-4-[(2R,5S,6S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]methoxy]-3,4,5-trimethyloxane |
| SMILES | CCC1O[C@H](OCC2O[C@H](Sc3ccccc3)C(C)[C@@H](O[C@H]3O[C@@H](CC)[C@@H](C)C(C)C3C)[C@@H]2C)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C34H56O5S/c1-11-28-21(5)19(3)23(7)32(36-28)35-18-30-25(9)31(26(10)34(38-30)40-27-16-14-13-15-17-27)39-33-24(8)20(4)22(6)29(12-2)37-33/h13-17,19-26,28-34H,11-12,18H2,1-10H3/t19-,20?,21-,22-,23?,24?,25+,26?,28?,29-,30?,31-,32-,33+,34+/m0/s1 |
| InChIKey | AODHXFYYSLVJEM-SKPRNRHZSA-N |
| XLogP | 8.26 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.88 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |