C32H52O7S — CID 121288482
(2S,4S,5S)-6-ethyl-2-[[(3S,4S,6R)-4-[(2R,5S,6S)-6-ethyl-3-hydroxy-4,5-dimethyloxan-2-yl]oxy-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]methoxy]-4,5-dimethyloxan-3-ol (PubChem CID 121288482) has the molecular formula C32H52O7S and a molecular weight of 580.83 g/mol. Its IUPAC name is (2S,4S,5S)-6-ethyl-2-[[(3S,4S,6R)-4-[(2R,5S,6S)-6-ethyl-3-hydroxy-4,5-dimethyloxan-2-yl]oxy-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]methoxy]-4,5-dimethyloxan-3-ol.
| Compound Name | (2S,4S,5S)-6-ethyl-2-[[(3S,4S,6R)-4-[(2R,5S,6S)-6-ethyl-3-hydroxy-4,5-dimethyloxan-2-yl]oxy-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]methoxy]-4,5-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 121288482 |
| Molecular Formula | C32H52O7S |
| Molecular Weight | 580.83 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | (2S,4S,5S)-6-ethyl-2-[[(3S,4S,6R)-4-[(2R,5S,6S)-6-ethyl-3-hydroxy-4,5-dimethyloxan-2-yl]oxy-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]methoxy]-4,5-dimethyloxan-3-ol |
| SMILES | CCC1O[C@H](OCC2O[C@H](Sc3ccccc3)C(C)[C@@H](O[C@H]3O[C@@H](CC)[C@@H](C)C(C)C3O)[C@@H]2C)C(O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C32H52O7S/c1-9-24-17(3)19(5)27(33)30(36-24)35-16-26-21(7)29(22(8)32(38-26)40-23-14-12-11-13-15-23)39-31-28(34)20(6)18(4)25(10-2)37-31/h11-15,17-22,24-34H,9-10,16H2,1-8H3/t17-,18-,19-,20?,21+,22?,24?,25-,26?,27?,28?,29-,30-,31+,32+/m0/s1 |
| InChIKey | IEODFRFWOLEUCL-YECDYYTMSA-N |
| XLogP | 5.71 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.83 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |