C28H51FO5 — CID 121288486
(2S,3S,6R)-2-ethyl-5-[(2R,5S,6S)-6-ethyl-3-[(2R,5S,6S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-4,5-dimethyloxan-2-yl]oxy-6-fluoro-3,4-dimethyloxane (PubChem CID 121288486) has the molecular formula C28H51FO5 and a molecular weight of 486.71 g/mol. Its IUPAC name is (2S,3S,6R)-2-ethyl-5-[(2R,5S,6S)-6-ethyl-3-[(2R,5S,6S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-4,5-dimethyloxan-2-yl]oxy-6-fluoro-3,4-dimethyloxane.
| Compound Name | (2S,3S,6R)-2-ethyl-5-[(2R,5S,6S)-6-ethyl-3-[(2R,5S,6S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-4,5-dimethyloxan-2-yl]oxy-6-fluoro-3,4-dimethyloxane |
|---|---|
| PubChem CID | 121288486 |
| Molecular Formula | C28H51FO5 |
| Molecular Weight | 486.71 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | (2S,3S,6R)-2-ethyl-5-[(2R,5S,6S)-6-ethyl-3-[(2R,5S,6S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-4,5-dimethyloxan-2-yl]oxy-6-fluoro-3,4-dimethyloxane |
| SMILES | CC[C@@H]1O[C@H](OC2C(C)[C@H](C)[C@H](CC)O[C@@H]2OC2C(C)[C@H](C)[C@H](CC)O[C@@H]2F)C(C)C(C)[C@@H]1C |
| InChI | InChI=1S/C28H51FO5/c1-11-21-16(6)18(8)24(26(29)30-21)33-28-25(19(9)17(7)23(13-3)32-28)34-27-20(10)14(4)15(5)22(12-2)31-27/h14-28H,11-13H2,1-10H3/t14?,15-,16-,17-,18?,19?,20?,21-,22-,23-,24?,25?,26-,27+,28+/m0/s1 |
| InChIKey | BSEXHXCIVLUCTQ-KGJGZRHMSA-N |
| XLogP | 6.58 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |