C17H20ClN3O — CID 121288664
2-(11-chloro-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)-1-cyclohexylethanol (PubChem CID 121288664) has the molecular formula C17H20ClN3O and a molecular weight of 317.82 g/mol. Its IUPAC name is 2-(11-chloro-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)-1-cyclohexylethanol.
| Compound Name | 2-(11-chloro-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)-1-cyclohexylethanol |
|---|---|
| PubChem CID | 121288664 |
| Molecular Formula | C17H20ClN3O |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-(11-chloro-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)-1-cyclohexylethanol |
| SMILES | OC(CC1c2ncc(Cl)cc2-c2cncn21)C1CCCCC1 |
| InChI | InChI=1S/C17H20ClN3O/c18-12-6-13-15-9-19-10-21(15)14(17(13)20-8-12)7-16(22)11-4-2-1-3-5-11/h6,8-11,14,16,22H,1-5,7H2 |
| InChIKey | SRJRHUWALHUANK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |