C8H8F8 — CID 121288782
(Z)-3-(1,2-difluoroethyl)-1,2,3,4,5,6-hexafluorohex-1-ene (PubChem CID 121288782) has the molecular formula C8H8F8 and a molecular weight of 256.14 g/mol. Its IUPAC name is (Z)-3-(1,2-difluoroethyl)-1,2,3,4,5,6-hexafluorohex-1-ene.
| Compound Name | (Z)-3-(1,2-difluoroethyl)-1,2,3,4,5,6-hexafluorohex-1-ene |
|---|---|
| PubChem CID | 121288782 |
| Molecular Formula | C8H8F8 |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (Z)-3-(1,2-difluoroethyl)-1,2,3,4,5,6-hexafluorohex-1-ene |
| SMILES | F/C=C(\F)C(F)(C(F)CF)C(F)C(F)CF |
| InChI | InChI=1S/C8H8F8/c9-1-4(12)7(15)8(16,5(13)2-10)6(14)3-11/h2,4,6-7H,1,3H2/b5-2- |
| InChIKey | MZRLOTWSCIXGTE-DJWKRKHSSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |