C48H45N7O — CID 121288930
(1,7-dimethyl-3,4-dihydro-2H-quinolin-6-yl)-[4-[[4-[[4-(4-pentylphenoxy)phenyl]diazenyl]naphthalen-1-yl]diazenyl]naphthalen-1-yl]diazene (PubChem CID 121288930) has the molecular formula C48H45N7O and a molecular weight of 735.94 g/mol. Its IUPAC name is (1,7-dimethyl-3,4-dihydro-2H-quinolin-6-yl)-[4-[[4-[[4-(4-pentylphenoxy)phenyl]diazenyl]naphthalen-1-yl]diazenyl]naphthalen-1-yl]diazene.
| Compound Name | (1,7-dimethyl-3,4-dihydro-2H-quinolin-6-yl)-[4-[[4-[[4-(4-pentylphenoxy)phenyl]diazenyl]naphthalen-1-yl]diazenyl]naphthalen-1-yl]diazene |
|---|---|
| PubChem CID | 121288930 |
| Molecular Formula | C48H45N7O |
| Molecular Weight | 735.94 g/mol |
| Exact Mass | 735.37 |
| IUPAC Name | (1,7-dimethyl-3,4-dihydro-2H-quinolin-6-yl)-[4-[[4-[[4-(4-pentylphenoxy)phenyl]diazenyl]naphthalen-1-yl]diazenyl]naphthalen-1-yl]diazene |
| SMILES | CCCCCc1ccc(Oc2ccc(/N=N/c3ccc(/N=N/c4ccc(/N=N/c5cc6c(cc5C)N(C)CCC6)c5ccccc45)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C48H45N7O/c1-4-5-6-12-34-18-22-37(23-19-34)56-38-24-20-36(21-25-38)49-50-43-26-27-44(40-15-8-7-14-39(40)43)51-52-45-28-29-46(42-17-10-9-16-41(42)45)53-54-47-32-35-13-11-30-55(3)48(35)31-33(47)2/h7-10,14-29,31-32H,4-6,11-13,30H2,1-3H3/b50-49+,52-51+,54-53+ |
| InChIKey | VCXDPQJTLSAKJS-QKZFEWMSSA-N |
| XLogP | 15.46 |
| TPSA | 86.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.94 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|