C35H33F2N3S3 — CID 121289302
4,7-bis[5-(2-fluoro-4-pentylphenyl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine (PubChem CID 121289302) has the molecular formula C35H33F2N3S3 and a molecular weight of 629.87 g/mol. Its IUPAC name is 4,7-bis[5-(2-fluoro-4-pentylphenyl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine.
| Compound Name | 4,7-bis[5-(2-fluoro-4-pentylphenyl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 121289302 |
| Molecular Formula | C35H33F2N3S3 |
| Molecular Weight | 629.87 g/mol |
| Exact Mass | 629.18 |
| IUPAC Name | 4,7-bis[5-(2-fluoro-4-pentylphenyl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine |
| SMILES | CCCCCc1ccc(-c2ccc(-c3cnc(-c4ccc(-c5ccc(CCCCC)cc5F)s4)c4nsnc34)s2)c(F)c1 |
| InChI | InChI=1S/C35H33F2N3S3/c1-3-5-7-9-22-11-13-24(27(36)19-22)29-15-16-31(41-29)26-21-38-34(35-33(26)39-43-40-35)32-18-17-30(42-32)25-14-12-23(20-28(25)37)10-8-6-4-2/h11-21H,3-10H2,1-2H3 |
| InChIKey | APEGBEDQVATPCY-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.87 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|