C40H55N5O3 — CID 121289624
3,3-bis[5-tert-butyl-2-(2-piperazin-1-ylethoxy)phenyl]-1H-indol-2-one (PubChem CID 121289624) has the molecular formula C40H55N5O3 and a molecular weight of 653.91 g/mol. Its IUPAC name is 3,3-bis[5-tert-butyl-2-(2-piperazin-1-ylethoxy)phenyl]-1H-indol-2-one.
| Compound Name | 3,3-bis[5-tert-butyl-2-(2-piperazin-1-ylethoxy)phenyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 121289624 |
| Molecular Formula | C40H55N5O3 |
| Molecular Weight | 653.91 g/mol |
| Exact Mass | 653.43 |
| IUPAC Name | 3,3-bis[5-tert-butyl-2-(2-piperazin-1-ylethoxy)phenyl]-1H-indol-2-one |
| SMILES | CC(C)(C)c1ccc(OCCN2CCNCC2)c(C2(c3cc(C(C)(C)C)ccc3OCCN3CCNCC3)C(=O)Nc3ccccc32)c1 |
| InChI | InChI=1S/C40H55N5O3/c1-38(2,3)29-11-13-35(47-25-23-44-19-15-41-16-20-44)32(27-29)40(31-9-7-8-10-34(31)43-37(40)46)33-28-30(39(4,5)6)12-14-36(33)48-26-24-45-21-17-42-18-22-45/h7-14,27-28,41-42H,15-26H2,1-6H3,(H,43,46) |
| InChIKey | PCNSXNJAOOZMIS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.91 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |