C36H31F3N4O6P2+2 — CID 121289774
2-[4-[4-[6-[4-[1-(2-phosphonoethyl)pyridin-1-ium-4-yl]phenyl]-2-(2,4,6-trifluorophenyl)pyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]ethylphosphonic acid (PubChem CID 121289774) has the molecular formula C36H31F3N4O6P2+2 and a molecular weight of 734.61 g/mol. Its IUPAC name is 2-[4-[4-[6-[4-[1-(2-phosphonoethyl)pyridin-1-ium-4-yl]phenyl]-2-(2,4,6-trifluorophenyl)pyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]ethylphosphonic acid.
| Compound Name | 2-[4-[4-[6-[4-[1-(2-phosphonoethyl)pyridin-1-ium-4-yl]phenyl]-2-(2,4,6-trifluorophenyl)pyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 121289774 |
| Molecular Formula | C36H31F3N4O6P2+2 |
| Molecular Weight | 734.61 g/mol |
| Exact Mass | 734.17 |
| IUPAC Name | 2-[4-[4-[6-[4-[1-(2-phosphonoethyl)pyridin-1-ium-4-yl]phenyl]-2-(2,4,6-trifluorophenyl)pyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]ethylphosphonic acid |
| SMILES | O=P(O)(O)CC[n+]1ccc(-c2ccc(-c3cc(-c4ccc(-c5cc[n+](CCP(=O)(O)O)cc5)cc4)nc(-c4c(F)cc(F)cc4F)n3)cc2)cc1 |
| InChI | InChI=1S/C36H29F3N4O6P2/c37-30-21-31(38)35(32(39)22-30)36-40-33(28-5-1-24(2-6-28)26-9-13-42(14-10-26)17-19-50(44,45)46)23-34(41-36)29-7-3-25(4-8-29)27-11-15-43(16-12-27)18-20-51(47,48)49/h1-16,21-23H,17-20H2,(H2-2,44,45,46,47,48,49)/p+2 |
| InChIKey | HYDYEOLQOFRIQM-UHFFFAOYSA-P |
| XLogP | 6.16 |
| TPSA | 148.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|