C47H47FN4O6+2 — CID 121289802
6-[4-[4-[5-(2-carboxyethyl)-6-[4-[1-(5-carboxypentyl)pyridin-1-ium-4-yl]phenyl]-2-(3-fluorophenyl)pyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]hexanoic acid (PubChem CID 121289802) has the molecular formula C47H47FN4O6+2 and a molecular weight of 782.91 g/mol. Its IUPAC name is 6-[4-[4-[5-(2-carboxyethyl)-6-[4-[1-(5-carboxypentyl)pyridin-1-ium-4-yl]phenyl]-2-(3-fluorophenyl)pyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[4-[4-[5-(2-carboxyethyl)-6-[4-[1-(5-carboxypentyl)pyridin-1-ium-4-yl]phenyl]-2-(3-fluorophenyl)pyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 121289802 |
| Molecular Formula | C47H47FN4O6+2 |
| Molecular Weight | 782.91 g/mol |
| Exact Mass | 782.35 |
| IUPAC Name | 6-[4-[4-[5-(2-carboxyethyl)-6-[4-[1-(5-carboxypentyl)pyridin-1-ium-4-yl]phenyl]-2-(3-fluorophenyl)pyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]hexanoic acid |
| SMILES | O=C(O)CCCCC[n+]1ccc(-c2ccc(-c3nc(-c4cccc(F)c4)nc(-c4ccc(-c5cc[n+](CCCCCC(=O)O)cc5)cc4)c3CCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C47H45FN4O6/c48-40-9-7-8-39(32-40)47-49-45(37-16-12-33(13-17-37)35-22-28-51(29-23-35)26-5-1-3-10-42(53)54)41(20-21-44(57)58)46(50-47)38-18-14-34(15-19-38)36-24-30-52(31-25-36)27-6-2-4-11-43(55)56/h7-9,12-19,22-25,28-32H,1-6,10-11,20-21,26-27H2,(H-2,53,54,55,56,57,58)/p+2 |
| InChIKey | ZYLWVALZHANROI-UHFFFAOYSA-P |
| XLogP | 8.83 |
| TPSA | 145.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.91 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|