C21H26N2O5 — CID 121290124
(4aR,9S)-9-[bis(prop-2-enyl)amino]-3-butoxy-4a-hydroxy-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione (PubChem CID 121290124) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is (4aR,9S)-9-[bis(prop-2-enyl)amino]-3-butoxy-4a-hydroxy-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione.
| Compound Name | (4aR,9S)-9-[bis(prop-2-enyl)amino]-3-butoxy-4a-hydroxy-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione |
|---|---|
| PubChem CID | 121290124 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (4aR,9S)-9-[bis(prop-2-enyl)amino]-3-butoxy-4a-hydroxy-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione |
| SMILES | C=CCN(CC=C)[C@@H]1c2onc(OCCCC)c2C(=O)[C@]2(O)C(=O)C=CCC12 |
| InChI | InChI=1S/C21H26N2O5/c1-4-7-13-27-20-16-18(28-22-20)17(23(11-5-2)12-6-3)14-9-8-10-15(24)21(14,26)19(16)25/h5-6,8,10,14,17,26H,2-4,7,9,11-13H2,1H3/t14?,17-,21+/m0/s1 |
| InChIKey | WZDOXEGPQXBOBT-NPSBWMBFSA-N |
| XLogP | 2.64 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|