About 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol
1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol (PubChem CID 121290171) has the molecular formula C10H23FN2O
and a molecular weight of 206.30 g/mol. Its IUPAC name is 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol.
Molecular Properties
| Compound Name | 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol |
| PubChem CID | 121290171 |
| Molecular Formula | C10H23FN2O |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol |
| SMILES | CCC(O)CCN[C@H](CCN)[C@H](C)F |
| InChI | InChI=1S/C10H23FN2O/c1-3-9(14)5-7-13-10(4-6-12)8(2)11/h8-10,13-14H,3-7,12H2,1-2H3/t8-,9?,10+/m0/s1 |
| InChIKey | LVNSYWPVXCRISJ-DJBFQZMMSA-N |
| XLogP | 0.81 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol?
The IUPAC name of 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol (CID 121290171) is 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol.
What is the SMILES notation for 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol?
The canonical SMILES for 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol is CCC(O)CCN[C@H](CCN)[C@H](C)F.
What is the InChIKey of 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol?
The InChIKey is LVNSYWPVXCRISJ-DJBFQZMMSA-N. The full InChI is InChI=1S/C10H23FN2O/c1-3-9(14)5-7-13-10(4-6-12)8(2)11/h8-10,13-14H,3-7,12H2,1-2H3/t8-,9?,10+/m0/s1.
What are the key properties of 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol?
1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol has a molecular weight of 206.30 g/mol, XLogP of 0.81, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(3R,4S)-1-amino-4-fluoropentan-3-yl]amino]pentan-3-ol is sourced from PubChem (CID 121290171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).