C26H29FN4O2 — CID 121290200
(4a-methyl-2,3,5,7,8,8a-hexahydro-1H-pyrido[3,4-b][1,4]oxazin-6-yl)-[3-[(1S)-1-[2-(4-fluorophenyl)phenyl]ethyl]imidazol-4-yl]methanone (PubChem CID 121290200) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is (4a-methyl-2,3,5,7,8,8a-hexahydro-1H-pyrido[3,4-b][1,4]oxazin-6-yl)-[3-[(1S)-1-[2-(4-fluorophenyl)phenyl]ethyl]imidazol-4-yl]methanone.
| Compound Name | (4a-methyl-2,3,5,7,8,8a-hexahydro-1H-pyrido[3,4-b][1,4]oxazin-6-yl)-[3-[(1S)-1-[2-(4-fluorophenyl)phenyl]ethyl]imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 121290200 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (4a-methyl-2,3,5,7,8,8a-hexahydro-1H-pyrido[3,4-b][1,4]oxazin-6-yl)-[3-[(1S)-1-[2-(4-fluorophenyl)phenyl]ethyl]imidazol-4-yl]methanone |
| SMILES | C[C@@H](c1ccccc1-c1ccc(F)cc1)n1cncc1C(=O)N1CCC2NCCOC2(C)C1 |
| InChI | InChI=1S/C26H29FN4O2/c1-18(21-5-3-4-6-22(21)19-7-9-20(27)10-8-19)31-17-28-15-23(31)25(32)30-13-11-24-26(2,16-30)33-14-12-29-24/h3-10,15,17-18,24,29H,11-14,16H2,1-2H3/t18-,24?,26?/m0/s1 |
| InChIKey | UQMFUSKIVUOSDE-UBSBWAOCSA-N |
| XLogP | 3.89 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |