C37H44N3O6S2+ — CID 121290211
5-(hexylsulfamoyl)-2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzenesulfonic acid (PubChem CID 121290211) has the molecular formula C37H44N3O6S2+ and a molecular weight of 690.91 g/mol. Its IUPAC name is 5-(hexylsulfamoyl)-2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzenesulfonic acid.
| Compound Name | 5-(hexylsulfamoyl)-2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 121290211 |
| Molecular Formula | C37H44N3O6S2+ |
| Molecular Weight | 690.91 g/mol |
| Exact Mass | 690.27 |
| IUPAC Name | 5-(hexylsulfamoyl)-2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzenesulfonic acid |
| SMILES | CCCCCCNS(=O)(=O)c1ccc(C2=c3cc4c5c(c3Oc3c2cc2c6c3CCCN6CCC2)CCC[N+]=5CCC4)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C37H43N3O6S2/c1-2-3-4-5-16-38-47(41,42)26-14-15-27(32(23-26)48(43,44)45)33-30-21-24-10-6-17-39-19-8-12-28(34(24)39)36(30)46-37-29-13-9-20-40-18-7-11-25(35(29)40)22-31(33)37/h14-15,21-23,38H,2-13,16-20H2,1H3/p+1 |
| InChIKey | BSVLBMPRDSPTGA-UHFFFAOYSA-O |
| XLogP | 4.23 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|