About 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile
2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile (PubChem CID 121291002) has the molecular formula C11H6N2O2S2
and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile.
Molecular Properties
| Compound Name | 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile |
| PubChem CID | 121291002 |
| Molecular Formula | C11H6N2O2S2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile |
| SMILES | Cc1cc(O)c2c(c1O)SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C11H6N2O2S2/c1-5-2-7(14)9-10(8(5)15)17-11(16-9)6(3-12)4-13/h2,14-15H,1H3 |
| InChIKey | JOSGASDGGVIZMY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile?
The IUPAC name of 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile (CID 121291002) is 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile.
What is the SMILES notation for 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile?
The canonical SMILES for 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile is Cc1cc(O)c2c(c1O)SC(=C(C#N)C#N)S2.
What is the InChIKey of 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile?
The InChIKey is JOSGASDGGVIZMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2O2S2/c1-5-2-7(14)9-10(8(5)15)17-11(16-9)6(3-12)4-13/h2,14-15H,1H3.
What are the key properties of 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile?
2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile has a molecular weight of 262.31 g/mol, XLogP of 2.86, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,7-dihydroxy-5-methyl-1,3-benzodithiol-2-ylidene)propanedinitrile is sourced from PubChem (CID 121291002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).