C14H23NO10 — CID 121291148
(4R,5R)-2,4-dihydroxy-5-(4-oxopentanoylamino)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 121291148) has the molecular formula C14H23NO10 and a molecular weight of 365.34 g/mol. Its IUPAC name is (4R,5R)-2,4-dihydroxy-5-(4-oxopentanoylamino)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (4R,5R)-2,4-dihydroxy-5-(4-oxopentanoylamino)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 121291148 |
| Molecular Formula | C14H23NO10 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (4R,5R)-2,4-dihydroxy-5-(4-oxopentanoylamino)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)CCC(=O)N[C@H]1C([C@H](O)[C@H](O)CO)OC(O)(C(=O)O)C[C@H]1O |
| InChI | InChI=1S/C14H23NO10/c1-6(17)2-3-9(20)15-10-7(18)4-14(24,13(22)23)25-12(10)11(21)8(19)5-16/h7-8,10-12,16,18-19,21,24H,2-5H2,1H3,(H,15,20)(H,22,23)/t7-,8-,10-,11-,12?,14?/m1/s1 |
| InChIKey | XORQVYPMXNTUFA-KNXIJNFBSA-N |
| XLogP | -3.52 |
| TPSA | 193.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |