C9H14O4 — CID 121291281
(6E)-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxole-5,8-diol (PubChem CID 121291281) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (6E)-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxole-5,8-diol.
| Compound Name | (6E)-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxole-5,8-diol |
|---|---|
| PubChem CID | 121291281 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (6E)-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxole-5,8-diol |
| SMILES | OC1/C=C\C(O)CC2OCOC2C1 |
| InChI | InChI=1S/C9H14O4/c10-6-1-2-7(11)4-9-8(3-6)12-5-13-9/h1-2,6-11H,3-5H2/b2-1- |
| InChIKey | LTOBISXFVIXGGG-UPHRSURJSA-N |
| XLogP | -0.20 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|