C19H26O4 — CID 121291455
(2S)-2-[3,5-dihydroxy-4-[(1R,6S)-3-methyl-6-propan-2-ylcyclohex-3-en-1-yl]phenyl]propanoic acid (PubChem CID 121291455) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (2S)-2-[3,5-dihydroxy-4-[(1R,6S)-3-methyl-6-propan-2-ylcyclohex-3-en-1-yl]phenyl]propanoic acid.
| Compound Name | (2S)-2-[3,5-dihydroxy-4-[(1R,6S)-3-methyl-6-propan-2-ylcyclohex-3-en-1-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 121291455 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (2S)-2-[3,5-dihydroxy-4-[(1R,6S)-3-methyl-6-propan-2-ylcyclohex-3-en-1-yl]phenyl]propanoic acid |
| SMILES | CC1=CC[C@@H](C(C)C)[C@H](c2c(O)cc([C@H](C)C(=O)O)cc2O)C1 |
| InChI | InChI=1S/C19H26O4/c1-10(2)14-6-5-11(3)7-15(14)18-16(20)8-13(9-17(18)21)12(4)19(22)23/h5,8-10,12,14-15,20-21H,6-7H2,1-4H3,(H,22,23)/t12-,14-,15+/m0/s1 |
| InChIKey | IBYIUWLFKJHJJC-AEGPPILISA-N |
| XLogP | 4.38 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|