C39H49N3O3 — CID 121291615
8',8',10',10'-tetramethyl-4',14'-bis(2-pyrrolidin-1-ylethoxy)spiro[1H-indole-3,2'-tricyclo[9.3.1.13,7]hexadeca-1(14),3,5,7(16),11(15),12-hexaene]-2-one (PubChem CID 121291615) has the molecular formula C39H49N3O3 and a molecular weight of 607.84 g/mol. Its IUPAC name is 8',8',10',10'-tetramethyl-4',14'-bis(2-pyrrolidin-1-ylethoxy)spiro[1H-indole-3,2'-tricyclo[9.3.1.13,7]hexadeca-1(14),3,5,7(16),11(15),12-hexaene]-2-one.
| Compound Name | 8',8',10',10'-tetramethyl-4',14'-bis(2-pyrrolidin-1-ylethoxy)spiro[1H-indole-3,2'-tricyclo[9.3.1.13,7]hexadeca-1(14),3,5,7(16),11(15),12-hexaene]-2-one |
|---|---|
| PubChem CID | 121291615 |
| Molecular Formula | C39H49N3O3 |
| Molecular Weight | 607.84 g/mol |
| Exact Mass | 607.38 |
| IUPAC Name | 8',8',10',10'-tetramethyl-4',14'-bis(2-pyrrolidin-1-ylethoxy)spiro[1H-indole-3,2'-tricyclo[9.3.1.13,7]hexadeca-1(14),3,5,7(16),11(15),12-hexaene]-2-one |
| SMILES | CC1(C)CC(C)(C)c2ccc(OCCN3CCCC3)c(c2)C2(C(=O)Nc3ccccc32)c2cc1ccc2OCCN1CCCC1 |
| InChI | InChI=1S/C39H49N3O3/c1-37(2)27-38(3,4)29-14-16-35(45-24-22-42-19-9-10-20-42)32(26-29)39(30-11-5-6-12-33(30)40-36(39)43)31-25-28(37)13-15-34(31)44-23-21-41-17-7-8-18-41/h5-6,11-16,25-26H,7-10,17-24,27H2,1-4H3,(H,40,43) |
| InChIKey | XWUOTWDKZCFVMA-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.84 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |