C39H29F9N2 — CID 121291894
4,6-bis[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-2-[2,4,6-tris(trifluoromethyl)phenyl]pyrimidine (PubChem CID 121291894) has the molecular formula C39H29F9N2 and a molecular weight of 696.66 g/mol. Its IUPAC name is 4,6-bis[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-2-[2,4,6-tris(trifluoromethyl)phenyl]pyrimidine.
| Compound Name | 4,6-bis[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-2-[2,4,6-tris(trifluoromethyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 121291894 |
| Molecular Formula | C39H29F9N2 |
| Molecular Weight | 696.66 g/mol |
| Exact Mass | 696.22 |
| IUPAC Name | 4,6-bis[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-2-[2,4,6-tris(trifluoromethyl)phenyl]pyrimidine |
| SMILES | C=C/C=C(\C=C/C)c1ccc(-c2cc(-c3ccc(C(/C=C\C)=C/C=C)cc3)nc(-c3c(C(F)(F)F)cc(C(F)(F)F)cc3C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C39H29F9N2/c1-5-9-24(10-6-2)26-13-17-28(18-14-26)33-23-34(29-19-15-27(16-20-29)25(11-7-3)12-8-4)50-36(49-33)35-31(38(43,44)45)21-30(37(40,41)42)22-32(35)39(46,47)48/h5-23H,1,3H2,2,4H3/b10-6-,12-8-,24-9+,25-11+ |
| InChIKey | HQHHJJCXJDFXHS-XJYCGBTOSA-N |
| XLogP | 12.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.66 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|