About 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole
1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole (PubChem CID 121292185) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole.
Molecular Properties
| Compound Name | 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole |
| PubChem CID | 121292185 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole |
| SMILES | CCn1nc(C)c2c1CCCC2 |
| InChI | InChI=1S/C10H16N2/c1-3-12-10-7-5-4-6-9(10)8(2)11-12/h3-7H2,1-2H3 |
| InChIKey | WXDTUAFNBCTGSJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole?
The IUPAC name of 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole (CID 121292185) is 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole.
What is the SMILES notation for 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole?
The canonical SMILES for 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole is CCn1nc(C)c2c1CCCC2.
What is the InChIKey of 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole?
The InChIKey is WXDTUAFNBCTGSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2/c1-3-12-10-7-5-4-6-9(10)8(2)11-12/h3-7H2,1-2H3.
What are the key properties of 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole?
1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole has a molecular weight of 164.25 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-4,5,6,7-tetrahydroindazole is sourced from PubChem (CID 121292185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).