6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride

C7H4BrClN2O2S — CID 121292260

IUPAC6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride
SMILESO=S(=O)(Cl)c1cnc2ccc(Br)cn12
InChIInChI=1S/C7H4BrClN2O2S/c8-5-1-2-6-10-3-7(11(6)4-5)14(9,12)13/h1-4H
InChIKeyBWGPUQQZJPMLNY-UHFFFAOYSA-N
MW295.55 g/mol
LogP2.02
Rot. Bonds1

About 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride

6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride (PubChem CID 121292260) has the molecular formula C7H4BrClN2O2S and a molecular weight of 295.55 g/mol. Its IUPAC name is 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride.

Molecular Properties

Compound Name6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride
PubChem CID121292260
Molecular FormulaC7H4BrClN2O2S
Molecular Weight295.55 g/mol
Exact Mass293.89
IUPAC Name6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride
SMILESO=S(=O)(Cl)c1cnc2ccc(Br)cn12
InChIInChI=1S/C7H4BrClN2O2S/c8-5-1-2-6-10-3-7(11(6)4-5)14(9,12)13/h1-4H
InChIKeyBWGPUQQZJPMLNY-UHFFFAOYSA-N
XLogP2.02
TPSA51.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.55
LogP ≤ 52.02
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The IUPAC name of 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride (CID 121292260) is 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride.
What is the SMILES notation for 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The canonical SMILES for 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride is O=S(=O)(Cl)c1cnc2ccc(Br)cn12.
What is the InChIKey of 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The InChIKey is BWGPUQQZJPMLNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrClN2O2S/c8-5-1-2-6-10-3-7(11(6)4-5)14(9,12)13/h1-4H.
What are the key properties of 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride?
6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride has a molecular weight of 295.55 g/mol, XLogP of 2.02, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride is sourced from PubChem (CID 121292260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).