About 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole
3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole (PubChem CID 121293166) has the molecular formula C19H14F3N3O
and a molecular weight of 357.34 g/mol. Its IUPAC name is 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole |
| PubChem CID | 121293166 |
| Molecular Formula | C19H14F3N3O |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cc(-c2ccccc2C(F)(F)F)c2nc[nH]c2c1 |
| InChI | InChI=1S/C19H14F3N3O/c1-10-17(11(2)26-25-10)12-7-14(18-16(8-12)23-9-24-18)13-5-3-4-6-15(13)19(20,21)22/h3-9H,1-2H3,(H,23,24) |
| InChIKey | UQKTYIGSANESIU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole?
The IUPAC name of 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole (CID 121293166) is 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole.
What is the SMILES notation for 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole?
The canonical SMILES for 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole is Cc1noc(C)c1-c1cc(-c2ccccc2C(F)(F)F)c2nc[nH]c2c1.
What is the InChIKey of 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole?
The InChIKey is UQKTYIGSANESIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3N3O/c1-10-17(11(2)26-25-10)12-7-14(18-16(8-12)23-9-24-18)13-5-3-4-6-15(13)19(20,21)22/h3-9H,1-2H3,(H,23,24).
What are the key properties of 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole?
3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole has a molecular weight of 357.34 g/mol, XLogP of 5.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-[7-[2-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]-1,2-oxazole is sourced from PubChem (CID 121293166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).