About ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate
ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate (PubChem CID 121293749) has the molecular formula C13H13BrFNO2
and a molecular weight of 314.15 g/mol. Its IUPAC name is ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate |
| PubChem CID | 121293749 |
| Molecular Formula | C13H13BrFNO2 |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate |
| SMILES | CCOC(=O)c1cc(F)c(Br)c2c(C)c(C)[nH]c12 |
| InChI | InChI=1S/C13H13BrFNO2/c1-4-18-13(17)8-5-9(15)11(14)10-6(2)7(3)16-12(8)10/h5,16H,4H2,1-3H3 |
| InChIKey | PDQCHZYOXPWTOO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate?
The IUPAC name of ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate (CID 121293749) is ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate.
What is the SMILES notation for ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate?
The canonical SMILES for ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate is CCOC(=O)c1cc(F)c(Br)c2c(C)c(C)[nH]c12.
What is the InChIKey of ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate?
The InChIKey is PDQCHZYOXPWTOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrFNO2/c1-4-18-13(17)8-5-9(15)11(14)10-6(2)7(3)16-12(8)10/h5,16H,4H2,1-3H3.
What are the key properties of ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate?
ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate has a molecular weight of 314.15 g/mol, XLogP of 3.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylate is sourced from PubChem (CID 121293749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).