C19H20FN3O2 — CID 121293770
5-fluoro-2,3-dimethyl-4-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole-7-carboxamide (PubChem CID 121293770) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 5-fluoro-2,3-dimethyl-4-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole-7-carboxamide.
| Compound Name | 5-fluoro-2,3-dimethyl-4-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 121293770 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 5-fluoro-2,3-dimethyl-4-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole-7-carboxamide |
| SMILES | C=CC(=O)N1CC=C(c2c(F)cc(C(N)=O)c3[nH]c(C)c(C)c23)CC1 |
| InChI | InChI=1S/C19H20FN3O2/c1-4-15(24)23-7-5-12(6-8-23)17-14(20)9-13(19(21)25)18-16(17)10(2)11(3)22-18/h4-5,9,22H,1,6-8H2,2-3H3,(H2,21,25) |
| InChIKey | DVUBXBJSFDKINA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|