C11H17ClN2O4S — CID 121294803
methyl 4-[[(2R)-butan-2-yl]sulfamoyl]-3-chloro-1-methylpyrrole-2-carboxylate (PubChem CID 121294803) has the molecular formula C11H17ClN2O4S and a molecular weight of 308.79 g/mol. Its IUPAC name is methyl 4-[[(2R)-butan-2-yl]sulfamoyl]-3-chloro-1-methylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[[(2R)-butan-2-yl]sulfamoyl]-3-chloro-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 121294803 |
| Molecular Formula | C11H17ClN2O4S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | methyl 4-[[(2R)-butan-2-yl]sulfamoyl]-3-chloro-1-methylpyrrole-2-carboxylate |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1cn(C)c(C(=O)OC)c1Cl |
| InChI | InChI=1S/C11H17ClN2O4S/c1-5-7(2)13-19(16,17)8-6-14(3)10(9(8)12)11(15)18-4/h6-7,13H,5H2,1-4H3/t7-/m1/s1 |
| InChIKey | STWANZJQZJPOIW-SSDOTTSWSA-N |
| XLogP | 1.54 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |