About 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride
1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride (PubChem CID 121295156) has the molecular formula C7H5ClN2OS2
and a molecular weight of 232.72 g/mol. Its IUPAC name is 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride.
Molecular Properties
| Compound Name | 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride |
| PubChem CID | 121295156 |
| Molecular Formula | C7H5ClN2OS2 |
| Molecular Weight | 232.72 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride |
| SMILES | Cl.O=C(S)c1cccc2nnsc12 |
| InChI | InChI=1S/C7H4N2OS2.ClH/c10-7(11)4-2-1-3-5-6(4)12-9-8-5;/h1-3H,(H,10,11);1H |
| InChIKey | YAKKREWTQBPFGJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.72 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride?
The IUPAC name of 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride (CID 121295156) is 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride.
What is the SMILES notation for 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride?
The canonical SMILES for 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride is Cl.O=C(S)c1cccc2nnsc12.
What is the InChIKey of 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride?
The InChIKey is YAKKREWTQBPFGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2OS2.ClH/c10-7(11)4-2-1-3-5-6(4)12-9-8-5;/h1-3H,(H,10,11);1H.
What are the key properties of 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride?
1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride has a molecular weight of 232.72 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-benzothiadiazole-7-carbothioic S-acid;hydrochloride is sourced from PubChem (CID 121295156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).