C48H34Cl2N2 — CID 121295829
4-[3-chloro-5-[3-chloro-5-[4-(N-phenylanilino)phenyl]phenyl]phenyl]-N,N-diphenylaniline (PubChem CID 121295829) has the molecular formula C48H34Cl2N2 and a molecular weight of 709.72 g/mol. Its IUPAC name is 4-[3-chloro-5-[3-chloro-5-[4-(N-phenylanilino)phenyl]phenyl]phenyl]-N,N-diphenylaniline.
| Compound Name | 4-[3-chloro-5-[3-chloro-5-[4-(N-phenylanilino)phenyl]phenyl]phenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 121295829 |
| Molecular Formula | C48H34Cl2N2 |
| Molecular Weight | 709.72 g/mol |
| Exact Mass | 708.21 |
| IUPAC Name | 4-[3-chloro-5-[3-chloro-5-[4-(N-phenylanilino)phenyl]phenyl]phenyl]-N,N-diphenylaniline |
| SMILES | Clc1cc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc(-c2cc(Cl)cc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c2)c1 |
| InChI | InChI=1S/C48H34Cl2N2/c49-41-31-37(35-21-25-47(26-22-35)51(43-13-5-1-6-14-43)44-15-7-2-8-16-44)29-39(33-41)40-30-38(32-42(50)34-40)36-23-27-48(28-24-36)52(45-17-9-3-10-18-45)46-19-11-4-12-20-46/h1-34H |
| InChIKey | BYTOLSRJIDACML-UHFFFAOYSA-N |
| XLogP | 14.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.72 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |