C25H20ClF3N6O4 — CID 121296415
2-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-(4-pyridin-2-yloxyanilino)-1,3,5-triazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 121296415) has the molecular formula C25H20ClF3N6O4 and a molecular weight of 560.92 g/mol. Its IUPAC name is 2-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-(4-pyridin-2-yloxyanilino)-1,3,5-triazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-(4-pyridin-2-yloxyanilino)-1,3,5-triazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 121296415 |
| Molecular Formula | C25H20ClF3N6O4 |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | 2-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-(4-pyridin-2-yloxyanilino)-1,3,5-triazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(Cn1c(=O)nc(Nc2ccc(Oc3ccccn3)cc2)n(Cc2ccc(Cl)cc2)c1=O)NCC(F)(F)F |
| InChI | InChI=1S/C25H20ClF3N6O4/c26-17-6-4-16(5-7-17)13-34-22(32-18-8-10-19(11-9-18)39-21-3-1-2-12-30-21)33-23(37)35(24(34)38)14-20(36)31-15-25(27,28)29/h1-12H,13-15H2,(H,31,36)(H,32,33,37) |
| InChIKey | RXYNFALWOGFABI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |