C21H30N2O4 — CID 121297103
4,8-dihydroxy-1-(3-methoxypropyl)-3-(2,4,6-trimethylphenyl)-1,8-diazaspiro[4.5]dec-3-en-2-one (PubChem CID 121297103) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 4,8-dihydroxy-1-(3-methoxypropyl)-3-(2,4,6-trimethylphenyl)-1,8-diazaspiro[4.5]dec-3-en-2-one.
| Compound Name | 4,8-dihydroxy-1-(3-methoxypropyl)-3-(2,4,6-trimethylphenyl)-1,8-diazaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 121297103 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 4,8-dihydroxy-1-(3-methoxypropyl)-3-(2,4,6-trimethylphenyl)-1,8-diazaspiro[4.5]dec-3-en-2-one |
| SMILES | COCCCN1C(=O)C(c2c(C)cc(C)cc2C)=C(O)C12CCN(O)CC2 |
| InChI | InChI=1S/C21H30N2O4/c1-14-12-15(2)17(16(3)13-14)18-19(24)21(6-9-22(26)10-7-21)23(20(18)25)8-5-11-27-4/h12-13,24,26H,5-11H2,1-4H3 |
| InChIKey | GMJXXJMVWRHQBV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|